About 2-(diethylamino)-N-[(2,3-dimethyl-1H-indol-5-yl)methyl]-2-phenylacetamide
2-(diethylamino)-N-[(2,3-dimethyl-1H-indol-5-yl)methyl]-2-phenylacetamide (PubChem CID 56552524) has the molecular formula C23H29N3O
and a molecular weight of 363.51 g/mol. Its IUPAC name is 2-(diethylamino)-N-[(2,3-dimethyl-1H-indol-5-yl)methyl]-2-phenylacetamide.
Molecular Properties
| Compound Name | 2-(diethylamino)-N-[(2,3-dimethyl-1H-indol-5-yl)methyl]-2-phenylacetamide |
| PubChem CID | 56552524 |
| Molecular Formula | C23H29N3O |
| Molecular Weight | 363.51 g/mol |
| Exact Mass | 363.23 |
| IUPAC Name | 2-(diethylamino)-N-[(2,3-dimethyl-1H-indol-5-yl)methyl]-2-phenylacetamide |
| SMILES | CCN(CC)C(C(=O)NCc1ccc2[nH]c(C)c(C)c2c1)c1ccccc1 |
| InChI | InChI=1S/C23H29N3O/c1-5-26(6-2)22(19-10-8-7-9-11-19)23(27)24-15-18-12-13-21-20(14-18)16(3)17(4)25-21/h7-14,22,25H,5-6,15H2,1-4H3,(H,24,27) |
| InChIKey | AHEJUONYLCWBDR-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.51 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|
Analyze 2-(diethylamino)-N-[(2,3-dimethyl-1H-indol-5-yl)methyl]-2-phenylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(diethylamino)-N-[(2,3-dimethyl-1H-indol-5-yl)methyl]-2-phenylacetamide?
The IUPAC name of 2-(diethylamino)-N-[(2,3-dimethyl-1H-indol-5-yl)methyl]-2-phenylacetamide (CID 56552524) is 2-(diethylamino)-N-[(2,3-dimethyl-1H-indol-5-yl)methyl]-2-phenylacetamide.
What is the SMILES notation for 2-(diethylamino)-N-[(2,3-dimethyl-1H-indol-5-yl)methyl]-2-phenylacetamide?
The canonical SMILES for 2-(diethylamino)-N-[(2,3-dimethyl-1H-indol-5-yl)methyl]-2-phenylacetamide is CCN(CC)C(C(=O)NCc1ccc2[nH]c(C)c(C)c2c1)c1ccccc1.
What is the InChIKey of 2-(diethylamino)-N-[(2,3-dimethyl-1H-indol-5-yl)methyl]-2-phenylacetamide?
The InChIKey is AHEJUONYLCWBDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H29N3O/c1-5-26(6-2)22(19-10-8-7-9-11-19)23(27)24-15-18-12-13-21-20(14-18)16(3)17(4)25-21/h7-14,22,25H,5-6,15H2,1-4H3,(H,24,27).
What are the key properties of 2-(diethylamino)-N-[(2,3-dimethyl-1H-indol-5-yl)methyl]-2-phenylacetamide?
2-(diethylamino)-N-[(2,3-dimethyl-1H-indol-5-yl)methyl]-2-phenylacetamide has a molecular weight of 363.51 g/mol, XLogP of 4.48, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(diethylamino)-N-[(2,3-dimethyl-1H-indol-5-yl)methyl]-2-phenylacetamide is sourced from PubChem (CID 56552524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).