C20H25N5O4S — CID 56553255
2-(5,7-dimethyl-2-oxo-1H-pyrazolo[1,5-a]pyrimidin-6-yl)-N-[2-[(2,5-dimethylphenyl)sulfonylamino]ethyl]acetamide (PubChem CID 56553255) has the molecular formula C20H25N5O4S and a molecular weight of 431.52 g/mol. Its IUPAC name is 2-(5,7-dimethyl-2-oxo-1H-pyrazolo[1,5-a]pyrimidin-6-yl)-N-[2-[(2,5-dimethylphenyl)sulfonylamino]ethyl]acetamide.
| Compound Name | 2-(5,7-dimethyl-2-oxo-1H-pyrazolo[1,5-a]pyrimidin-6-yl)-N-[2-[(2,5-dimethylphenyl)sulfonylamino]ethyl]acetamide |
|---|---|
| PubChem CID | 56553255 |
| Molecular Formula | C20H25N5O4S |
| Molecular Weight | 431.52 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | 2-(5,7-dimethyl-2-oxo-1H-pyrazolo[1,5-a]pyrimidin-6-yl)-N-[2-[(2,5-dimethylphenyl)sulfonylamino]ethyl]acetamide |
| SMILES | Cc1ccc(C)c(S(=O)(=O)NCCNC(=O)Cc2c(C)nc3cc(=O)[nH]n3c2C)c1 |
| InChI | InChI=1S/C20H25N5O4S/c1-12-5-6-13(2)17(9-12)30(28,29)22-8-7-21-19(26)10-16-14(3)23-18-11-20(27)24-25(18)15(16)4/h5-6,9,11,22H,7-8,10H2,1-4H3,(H,21,26)(H,24,27) |
| InChIKey | PTZZDEBXFHNXHJ-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.52 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|