C20H20FN3O3 — CID 56553337
N-[2-(3,4-dimethoxyphenyl)ethyl]-4-(4-fluorophenoxy)pyrimidin-2-amine (PubChem CID 56553337) has the molecular formula C20H20FN3O3 and a molecular weight of 369.40 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-4-(4-fluorophenoxy)pyrimidin-2-amine.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-4-(4-fluorophenoxy)pyrimidin-2-amine |
|---|---|
| PubChem CID | 56553337 |
| Molecular Formula | C20H20FN3O3 |
| Molecular Weight | 369.40 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-4-(4-fluorophenoxy)pyrimidin-2-amine |
| SMILES | COc1ccc(CCNc2nccc(Oc3ccc(F)cc3)n2)cc1OC |
| InChI | InChI=1S/C20H20FN3O3/c1-25-17-8-3-14(13-18(17)26-2)9-11-22-20-23-12-10-19(24-20)27-16-6-4-15(21)5-7-16/h3-8,10,12-13H,9,11H2,1-2H3,(H,22,23,24) |
| InChIKey | UJUIIKPJLFQKEA-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 65.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.40 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |