C21H24Cl2N2O2 — CID 56553596
N-[(3,4-dichlorophenyl)methyl]-N-ethyl-3-(morpholin-4-ylmethyl)benzamide (PubChem CID 56553596) has the molecular formula C21H24Cl2N2O2 and a molecular weight of 407.34 g/mol. Its IUPAC name is N-[(3,4-dichlorophenyl)methyl]-N-ethyl-3-(morpholin-4-ylmethyl)benzamide.
| Compound Name | N-[(3,4-dichlorophenyl)methyl]-N-ethyl-3-(morpholin-4-ylmethyl)benzamide |
|---|---|
| PubChem CID | 56553596 |
| Molecular Formula | C21H24Cl2N2O2 |
| Molecular Weight | 407.34 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | N-[(3,4-dichlorophenyl)methyl]-N-ethyl-3-(morpholin-4-ylmethyl)benzamide |
| SMILES | CCN(Cc1ccc(Cl)c(Cl)c1)C(=O)c1cccc(CN2CCOCC2)c1 |
| InChI | InChI=1S/C21H24Cl2N2O2/c1-2-25(15-17-6-7-19(22)20(23)13-17)21(26)18-5-3-4-16(12-18)14-24-8-10-27-11-9-24/h3-7,12-13H,2,8-11,14-15H2,1H3 |
| InChIKey | GWMURFSDOQLGFV-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.34 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |