C16H26O3 — CID 565557
2-tert-butyl-5-methyl-4a-prop-2-enyl-6,7,8,8a-tetrahydro-5H-benzo[d][1,3]dioxin-4-one (PubChem CID 565557) has the molecular formula C16H26O3 and a molecular weight of 266.38 g/mol. Its IUPAC name is 2-tert-butyl-5-methyl-4a-prop-2-enyl-6,7,8,8a-tetrahydro-5H-benzo[d][1,3]dioxin-4-one.
| Compound Name | 2-tert-butyl-5-methyl-4a-prop-2-enyl-6,7,8,8a-tetrahydro-5H-benzo[d][1,3]dioxin-4-one |
|---|---|
| PubChem CID | 565557 |
| Molecular Formula | C16H26O3 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.19 |
| IUPAC Name | 2-tert-butyl-5-methyl-4a-prop-2-enyl-6,7,8,8a-tetrahydro-5H-benzo[d][1,3]dioxin-4-one |
| SMILES | C=CCC12C(=O)OC(C(C)(C)C)OC1CCCC2C |
| InChI | InChI=1S/C16H26O3/c1-6-10-16-11(2)8-7-9-12(16)18-14(15(3,4)5)19-13(16)17/h6,11-12,14H,1,7-10H2,2-5H3 |
| InChIKey | MSSLKTFATXLLFP-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|