C24H25N5OS — CID 56556056
6-methyl-N-[4-(3-methylpyrrolidin-1-yl)phenyl]-1-(thiophen-2-ylmethyl)pyrazolo[3,4-b]pyridine-4-carboxamide (PubChem CID 56556056) has the molecular formula C24H25N5OS and a molecular weight of 431.57 g/mol. Its IUPAC name is 6-methyl-N-[4-(3-methylpyrrolidin-1-yl)phenyl]-1-(thiophen-2-ylmethyl)pyrazolo[3,4-b]pyridine-4-carboxamide.
| Compound Name | 6-methyl-N-[4-(3-methylpyrrolidin-1-yl)phenyl]-1-(thiophen-2-ylmethyl)pyrazolo[3,4-b]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 56556056 |
| Molecular Formula | C24H25N5OS |
| Molecular Weight | 431.57 g/mol |
| Exact Mass | 431.18 |
| IUPAC Name | 6-methyl-N-[4-(3-methylpyrrolidin-1-yl)phenyl]-1-(thiophen-2-ylmethyl)pyrazolo[3,4-b]pyridine-4-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2ccc(N3CCC(C)C3)cc2)c2cnn(Cc3cccs3)c2n1 |
| InChI | InChI=1S/C24H25N5OS/c1-16-9-10-28(14-16)19-7-5-18(6-8-19)27-24(30)21-12-17(2)26-23-22(21)13-25-29(23)15-20-4-3-11-31-20/h3-8,11-13,16H,9-10,14-15H2,1-2H3,(H,27,30) |
| InChIKey | VNYVNJZBDFBXPP-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.57 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|