C21H23BrFN3O2 — CID 56556179
2-bromo-5-fluoro-N-[3-[4-(3-methylpyrrolidin-1-yl)anilino]-3-oxopropyl]benzamide (PubChem CID 56556179) has the molecular formula C21H23BrFN3O2 and a molecular weight of 448.34 g/mol. Its IUPAC name is 2-bromo-5-fluoro-N-[3-[4-(3-methylpyrrolidin-1-yl)anilino]-3-oxopropyl]benzamide.
| Compound Name | 2-bromo-5-fluoro-N-[3-[4-(3-methylpyrrolidin-1-yl)anilino]-3-oxopropyl]benzamide |
|---|---|
| PubChem CID | 56556179 |
| Molecular Formula | C21H23BrFN3O2 |
| Molecular Weight | 448.34 g/mol |
| Exact Mass | 447.10 |
| IUPAC Name | 2-bromo-5-fluoro-N-[3-[4-(3-methylpyrrolidin-1-yl)anilino]-3-oxopropyl]benzamide |
| SMILES | CC1CCN(c2ccc(NC(=O)CCNC(=O)c3cc(F)ccc3Br)cc2)C1 |
| InChI | InChI=1S/C21H23BrFN3O2/c1-14-9-11-26(13-14)17-5-3-16(4-6-17)25-20(27)8-10-24-21(28)18-12-15(23)2-7-19(18)22/h2-7,12,14H,8-11,13H2,1H3,(H,24,28)(H,25,27) |
| InChIKey | BFTOFWSCINXGKM-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.34 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|