C15H21N3O6S2 — CID 56556817
N-(3-morpholin-4-ylsulfonylphenyl)-1,1-dioxo-1,4-thiazinane-4-carboxamide (PubChem CID 56556817) has the molecular formula C15H21N3O6S2 and a molecular weight of 403.48 g/mol. Its IUPAC name is N-(3-morpholin-4-ylsulfonylphenyl)-1,1-dioxo-1,4-thiazinane-4-carboxamide.
| Compound Name | N-(3-morpholin-4-ylsulfonylphenyl)-1,1-dioxo-1,4-thiazinane-4-carboxamide |
|---|---|
| PubChem CID | 56556817 |
| Molecular Formula | C15H21N3O6S2 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.09 |
| IUPAC Name | N-(3-morpholin-4-ylsulfonylphenyl)-1,1-dioxo-1,4-thiazinane-4-carboxamide |
| SMILES | O=C(Nc1cccc(S(=O)(=O)N2CCOCC2)c1)N1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C15H21N3O6S2/c19-15(17-6-10-25(20,21)11-7-17)16-13-2-1-3-14(12-13)26(22,23)18-4-8-24-9-5-18/h1-3,12H,4-11H2,(H,16,19) |
| InChIKey | XHZIWYYRXZGEKC-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |