C19H21N5O6S — CID 56558807
ethyl N-[2-[[2-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)sulfonylamino]benzoyl]amino]ethyl]carbamate (PubChem CID 56558807) has the molecular formula C19H21N5O6S and a molecular weight of 447.47 g/mol. Its IUPAC name is ethyl N-[2-[[2-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)sulfonylamino]benzoyl]amino]ethyl]carbamate.
| Compound Name | ethyl N-[2-[[2-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)sulfonylamino]benzoyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 56558807 |
| Molecular Formula | C19H21N5O6S |
| Molecular Weight | 447.47 g/mol |
| Exact Mass | 447.12 |
| IUPAC Name | ethyl N-[2-[[2-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)sulfonylamino]benzoyl]amino]ethyl]carbamate |
| SMILES | CCOC(=O)NCCNC(=O)c1ccccc1NS(=O)(=O)c1ccc2[nH]c(=O)[nH]c2c1 |
| InChI | InChI=1S/C19H21N5O6S/c1-2-30-19(27)21-10-9-20-17(25)13-5-3-4-6-14(13)24-31(28,29)12-7-8-15-16(11-12)23-18(26)22-15/h3-8,11,24H,2,9-10H2,1H3,(H,20,25)(H,21,27)(H2,22,23,26) |
| InChIKey | DUXYRNBOYLLDBO-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 162.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.47 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|