About 2,5-dipropyloxolane
2,5-dipropyloxolane (PubChem CID 565616) has the molecular formula C10H20O
and a molecular weight of 156.27 g/mol. Its IUPAC name is 2,5-dipropyloxolane.
Molecular Properties
| Compound Name | 2,5-dipropyloxolane |
| PubChem CID | 565616 |
| Molecular Formula | C10H20O |
| Molecular Weight | 156.27 g/mol |
| Exact Mass | 156.15 |
| IUPAC Name | 2,5-dipropyloxolane |
| SMILES | CCCC1CCC(CCC)O1 |
| InChI | InChI=1S/C10H20O/c1-3-5-9-7-8-10(11-9)6-4-2/h9-10H,3-8H2,1-2H3 |
| InChIKey | DJLOLYHMQTXRPV-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.27 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,5-dipropyloxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dipropyloxolane?
The IUPAC name of 2,5-dipropyloxolane (CID 565616) is 2,5-dipropyloxolane.
What is the SMILES notation for 2,5-dipropyloxolane?
The canonical SMILES for 2,5-dipropyloxolane is CCCC1CCC(CCC)O1.
What is the InChIKey of 2,5-dipropyloxolane?
The InChIKey is DJLOLYHMQTXRPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O/c1-3-5-9-7-8-10(11-9)6-4-2/h9-10H,3-8H2,1-2H3.
What are the key properties of 2,5-dipropyloxolane?
2,5-dipropyloxolane has a molecular weight of 156.27 g/mol, XLogP of 3.13, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dipropyloxolane is sourced from PubChem (CID 565616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).