C19H20Cl2N4O3 — CID 56562611
N-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-7,7-dimethyl-2,5-dioxo-6,8-dihydro-1H-quinoline-3-carboxamide (PubChem CID 56562611) has the molecular formula C19H20Cl2N4O3 and a molecular weight of 423.30 g/mol. Its IUPAC name is N-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-7,7-dimethyl-2,5-dioxo-6,8-dihydro-1H-quinoline-3-carboxamide.
| Compound Name | N-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-7,7-dimethyl-2,5-dioxo-6,8-dihydro-1H-quinoline-3-carboxamide |
|---|---|
| PubChem CID | 56562611 |
| Molecular Formula | C19H20Cl2N4O3 |
| Molecular Weight | 423.30 g/mol |
| Exact Mass | 422.09 |
| IUPAC Name | N-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-7,7-dimethyl-2,5-dioxo-6,8-dihydro-1H-quinoline-3-carboxamide |
| SMILES | CC1(C)CC(=O)c2cc(C(=O)NCCNc3ncc(Cl)cc3Cl)c(=O)[nH]c2C1 |
| InChI | InChI=1S/C19H20Cl2N4O3/c1-19(2)7-14-11(15(26)8-19)6-12(18(28)25-14)17(27)23-4-3-22-16-13(21)5-10(20)9-24-16/h5-6,9H,3-4,7-8H2,1-2H3,(H,22,24)(H,23,27)(H,25,28) |
| InChIKey | VGGIYQNBNOSJLL-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.30 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|