C21H23N5O4 — CID 56562685
7,7-dimethyl-2,5-dioxo-N-[3-(3-oxo-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]-6,8-dihydro-1H-quinoline-3-carboxamide (PubChem CID 56562685) has the molecular formula C21H23N5O4 and a molecular weight of 409.45 g/mol. Its IUPAC name is 7,7-dimethyl-2,5-dioxo-N-[3-(3-oxo-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]-6,8-dihydro-1H-quinoline-3-carboxamide.
| Compound Name | 7,7-dimethyl-2,5-dioxo-N-[3-(3-oxo-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]-6,8-dihydro-1H-quinoline-3-carboxamide |
|---|---|
| PubChem CID | 56562685 |
| Molecular Formula | C21H23N5O4 |
| Molecular Weight | 409.45 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | 7,7-dimethyl-2,5-dioxo-N-[3-(3-oxo-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]-6,8-dihydro-1H-quinoline-3-carboxamide |
| SMILES | CC1(C)CC(=O)c2cc(C(=O)NCCCn3nc4ccccn4c3=O)c(=O)[nH]c2C1 |
| InChI | InChI=1S/C21H23N5O4/c1-21(2)11-15-13(16(27)12-21)10-14(19(29)23-15)18(28)22-7-5-9-26-20(30)25-8-4-3-6-17(25)24-26/h3-4,6,8,10H,5,7,9,11-12H2,1-2H3,(H,22,28)(H,23,29) |
| InChIKey | FHCXQFNBMRYQKW-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 118.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.45 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|