C22H24ClN3O5 — CID 56563066
2-chloro-4-[[4-(2,3-dihydro-1,4-benzoxazin-4-yl)-4-oxobutanoyl]amino]-N-(2-methoxyethyl)benzamide (PubChem CID 56563066) has the molecular formula C22H24ClN3O5 and a molecular weight of 445.90 g/mol. Its IUPAC name is 2-chloro-4-[[4-(2,3-dihydro-1,4-benzoxazin-4-yl)-4-oxobutanoyl]amino]-N-(2-methoxyethyl)benzamide.
| Compound Name | 2-chloro-4-[[4-(2,3-dihydro-1,4-benzoxazin-4-yl)-4-oxobutanoyl]amino]-N-(2-methoxyethyl)benzamide |
|---|---|
| PubChem CID | 56563066 |
| Molecular Formula | C22H24ClN3O5 |
| Molecular Weight | 445.90 g/mol |
| Exact Mass | 445.14 |
| IUPAC Name | 2-chloro-4-[[4-(2,3-dihydro-1,4-benzoxazin-4-yl)-4-oxobutanoyl]amino]-N-(2-methoxyethyl)benzamide |
| SMILES | COCCNC(=O)c1ccc(NC(=O)CCC(=O)N2CCOc3ccccc32)cc1Cl |
| InChI | InChI=1S/C22H24ClN3O5/c1-30-12-10-24-22(29)16-7-6-15(14-17(16)23)25-20(27)8-9-21(28)26-11-13-31-19-5-3-2-4-18(19)26/h2-7,14H,8-13H2,1H3,(H,24,29)(H,25,27) |
| InChIKey | GQCSMVFXJJJNSW-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.90 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|