C14H18BrN3OS — CID 56563157
4-bromo-N-ethyl-5-propan-2-yl-N-(thiophen-2-ylmethyl)-1H-pyrazole-3-carboxamide (PubChem CID 56563157) has the molecular formula C14H18BrN3OS and a molecular weight of 356.29 g/mol. Its IUPAC name is 4-bromo-N-ethyl-5-propan-2-yl-N-(thiophen-2-ylmethyl)-1H-pyrazole-3-carboxamide.
| Compound Name | 4-bromo-N-ethyl-5-propan-2-yl-N-(thiophen-2-ylmethyl)-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 56563157 |
| Molecular Formula | C14H18BrN3OS |
| Molecular Weight | 356.29 g/mol |
| Exact Mass | 355.04 |
| IUPAC Name | 4-bromo-N-ethyl-5-propan-2-yl-N-(thiophen-2-ylmethyl)-1H-pyrazole-3-carboxamide |
| SMILES | CCN(Cc1cccs1)C(=O)c1n[nH]c(C(C)C)c1Br |
| InChI | InChI=1S/C14H18BrN3OS/c1-4-18(8-10-6-5-7-20-10)14(19)13-11(15)12(9(2)3)16-17-13/h5-7,9H,4,8H2,1-3H3,(H,16,17) |
| InChIKey | ANWAEKALCAFLMS-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.29 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |