C25H35N3O2S — CID 56564277
2-(4-tert-butylphenyl)sulfanyl-N-(3-morpholin-4-ylpropyl)-N-(pyridin-4-ylmethyl)acetamide (PubChem CID 56564277) has the molecular formula C25H35N3O2S and a molecular weight of 441.64 g/mol. Its IUPAC name is 2-(4-tert-butylphenyl)sulfanyl-N-(3-morpholin-4-ylpropyl)-N-(pyridin-4-ylmethyl)acetamide.
| Compound Name | 2-(4-tert-butylphenyl)sulfanyl-N-(3-morpholin-4-ylpropyl)-N-(pyridin-4-ylmethyl)acetamide |
|---|---|
| PubChem CID | 56564277 |
| Molecular Formula | C25H35N3O2S |
| Molecular Weight | 441.64 g/mol |
| Exact Mass | 441.24 |
| IUPAC Name | 2-(4-tert-butylphenyl)sulfanyl-N-(3-morpholin-4-ylpropyl)-N-(pyridin-4-ylmethyl)acetamide |
| SMILES | CC(C)(C)c1ccc(SCC(=O)N(CCCN2CCOCC2)Cc2ccncc2)cc1 |
| InChI | InChI=1S/C25H35N3O2S/c1-25(2,3)22-5-7-23(8-6-22)31-20-24(29)28(19-21-9-11-26-12-10-21)14-4-13-27-15-17-30-18-16-27/h5-12H,4,13-20H2,1-3H3 |
| InChIKey | LBOGDWVVRAYWCP-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.64 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |