C22H23N5O3 — CID 56565821
7,7-dimethyl-N-[(5-methyl-1H-1,2,4-triazol-3-yl)-phenylmethyl]-2,5-dioxo-6,8-dihydro-1H-quinoline-3-carboxamide (PubChem CID 56565821) has the molecular formula C22H23N5O3 and a molecular weight of 405.46 g/mol. Its IUPAC name is 7,7-dimethyl-N-[(5-methyl-1H-1,2,4-triazol-3-yl)-phenylmethyl]-2,5-dioxo-6,8-dihydro-1H-quinoline-3-carboxamide.
| Compound Name | 7,7-dimethyl-N-[(5-methyl-1H-1,2,4-triazol-3-yl)-phenylmethyl]-2,5-dioxo-6,8-dihydro-1H-quinoline-3-carboxamide |
|---|---|
| PubChem CID | 56565821 |
| Molecular Formula | C22H23N5O3 |
| Molecular Weight | 405.46 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | 7,7-dimethyl-N-[(5-methyl-1H-1,2,4-triazol-3-yl)-phenylmethyl]-2,5-dioxo-6,8-dihydro-1H-quinoline-3-carboxamide |
| SMILES | Cc1nc(C(NC(=O)c2cc3c([nH]c2=O)CC(C)(C)CC3=O)c2ccccc2)n[nH]1 |
| InChI | InChI=1S/C22H23N5O3/c1-12-23-19(27-26-12)18(13-7-5-4-6-8-13)25-21(30)15-9-14-16(24-20(15)29)10-22(2,3)11-17(14)28/h4-9,18H,10-11H2,1-3H3,(H,24,29)(H,25,30)(H,23,26,27) |
| InChIKey | MEUCDWRKLGVGND-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 120.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.46 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |