C19H17F2N3O4S — CID 56566681
1-[[4-(difluoromethoxy)phenyl]methyl]-3-[4-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]phenyl]urea (PubChem CID 56566681) has the molecular formula C19H17F2N3O4S and a molecular weight of 421.43 g/mol. Its IUPAC name is 1-[[4-(difluoromethoxy)phenyl]methyl]-3-[4-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]phenyl]urea.
| Compound Name | 1-[[4-(difluoromethoxy)phenyl]methyl]-3-[4-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]phenyl]urea |
|---|---|
| PubChem CID | 56566681 |
| Molecular Formula | C19H17F2N3O4S |
| Molecular Weight | 421.43 g/mol |
| Exact Mass | 421.09 |
| IUPAC Name | 1-[[4-(difluoromethoxy)phenyl]methyl]-3-[4-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]phenyl]urea |
| SMILES | O=C(NCc1ccc(OC(F)F)cc1)Nc1ccc(CN2C(=O)CSC2=O)cc1 |
| InChI | InChI=1S/C19H17F2N3O4S/c20-17(21)28-15-7-3-12(4-8-15)9-22-18(26)23-14-5-1-13(2-6-14)10-24-16(25)11-29-19(24)27/h1-8,17H,9-11H2,(H2,22,23,26) |
| InChIKey | WOAARZQZHGUJKH-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.43 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|