C25H33N3O4 — CID 56566838
N-(3-methoxypropyl)-1-[2-[(2-methyl-2,3-dihydroindol-1-yl)methyl]furan-3-carbonyl]piperidine-4-carboxamide (PubChem CID 56566838) has the molecular formula C25H33N3O4 and a molecular weight of 439.56 g/mol. Its IUPAC name is N-(3-methoxypropyl)-1-[2-[(2-methyl-2,3-dihydroindol-1-yl)methyl]furan-3-carbonyl]piperidine-4-carboxamide.
| Compound Name | N-(3-methoxypropyl)-1-[2-[(2-methyl-2,3-dihydroindol-1-yl)methyl]furan-3-carbonyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 56566838 |
| Molecular Formula | C25H33N3O4 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.25 |
| IUPAC Name | N-(3-methoxypropyl)-1-[2-[(2-methyl-2,3-dihydroindol-1-yl)methyl]furan-3-carbonyl]piperidine-4-carboxamide |
| SMILES | COCCCNC(=O)C1CCN(C(=O)c2ccoc2CN2c3ccccc3CC2C)CC1 |
| InChI | InChI=1S/C25H33N3O4/c1-18-16-20-6-3-4-7-22(20)28(18)17-23-21(10-15-32-23)25(30)27-12-8-19(9-13-27)24(29)26-11-5-14-31-2/h3-4,6-7,10,15,18-19H,5,8-9,11-14,16-17H2,1-2H3,(H,26,29) |
| InChIKey | PFMXGCZEBYURIL-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 75.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|