C17H22BrN3O2 — CID 56566879
4-bromo-N-(2-butoxyphenyl)-5-propan-2-yl-1H-pyrazole-3-carboxamide (PubChem CID 56566879) has the molecular formula C17H22BrN3O2 and a molecular weight of 380.29 g/mol. Its IUPAC name is 4-bromo-N-(2-butoxyphenyl)-5-propan-2-yl-1H-pyrazole-3-carboxamide.
| Compound Name | 4-bromo-N-(2-butoxyphenyl)-5-propan-2-yl-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 56566879 |
| Molecular Formula | C17H22BrN3O2 |
| Molecular Weight | 380.29 g/mol |
| Exact Mass | 379.09 |
| IUPAC Name | 4-bromo-N-(2-butoxyphenyl)-5-propan-2-yl-1H-pyrazole-3-carboxamide |
| SMILES | CCCCOc1ccccc1NC(=O)c1n[nH]c(C(C)C)c1Br |
| InChI | InChI=1S/C17H22BrN3O2/c1-4-5-10-23-13-9-7-6-8-12(13)19-17(22)16-14(18)15(11(2)3)20-21-16/h6-9,11H,4-5,10H2,1-3H3,(H,19,22)(H,20,21) |
| InChIKey | IVRGPVHZYYSNMP-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.29 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|