C18H25BrN4O — CID 56567094
4-bromo-N-[4-(N-methylanilino)butyl]-5-propan-2-yl-1H-pyrazole-3-carboxamide (PubChem CID 56567094) has the molecular formula C18H25BrN4O and a molecular weight of 393.33 g/mol. Its IUPAC name is 4-bromo-N-[4-(N-methylanilino)butyl]-5-propan-2-yl-1H-pyrazole-3-carboxamide.
| Compound Name | 4-bromo-N-[4-(N-methylanilino)butyl]-5-propan-2-yl-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 56567094 |
| Molecular Formula | C18H25BrN4O |
| Molecular Weight | 393.33 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | 4-bromo-N-[4-(N-methylanilino)butyl]-5-propan-2-yl-1H-pyrazole-3-carboxamide |
| SMILES | CC(C)c1[nH]nc(C(=O)NCCCCN(C)c2ccccc2)c1Br |
| InChI | InChI=1S/C18H25BrN4O/c1-13(2)16-15(19)17(22-21-16)18(24)20-11-7-8-12-23(3)14-9-5-4-6-10-14/h4-6,9-10,13H,7-8,11-12H2,1-3H3,(H,20,24)(H,21,22) |
| InChIKey | PVUSRZRLVWIJAL-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.33 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|