C17H20N2O6 — CID 565678
(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 3,5-dinitrobenzoate (PubChem CID 565678) has the molecular formula C17H20N2O6 and a molecular weight of 348.36 g/mol. Its IUPAC name is (1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 3,5-dinitrobenzoate.
| Compound Name | (1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 3,5-dinitrobenzoate |
|---|---|
| PubChem CID | 565678 |
| Molecular Formula | C17H20N2O6 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | (1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 3,5-dinitrobenzoate |
| SMILES | CC1(C)C2CCC1(C)C(OC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1)C2 |
| InChI | InChI=1S/C17H20N2O6/c1-16(2)11-4-5-17(16,3)14(8-11)25-15(20)10-6-12(18(21)22)9-13(7-10)19(23)24/h6-7,9,11,14H,4-5,8H2,1-3H3 |
| InChIKey | QOMUVRIFQWSYPD-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 112.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|