C23H24N4O3 — CID 56568362
N-methyl-4-[(E)-3-[2-methyl-6-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)anilino]-3-oxoprop-1-enyl]benzamide (PubChem CID 56568362) has the molecular formula C23H24N4O3 and a molecular weight of 404.47 g/mol. Its IUPAC name is N-methyl-4-[(E)-3-[2-methyl-6-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)anilino]-3-oxoprop-1-enyl]benzamide.
| Compound Name | N-methyl-4-[(E)-3-[2-methyl-6-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)anilino]-3-oxoprop-1-enyl]benzamide |
|---|---|
| PubChem CID | 56568362 |
| Molecular Formula | C23H24N4O3 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | N-methyl-4-[(E)-3-[2-methyl-6-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)anilino]-3-oxoprop-1-enyl]benzamide |
| SMILES | CNC(=O)c1ccc(/C=C/C(=O)Nc2c(C)cccc2-c2nc(C(C)C)no2)cc1 |
| InChI | InChI=1S/C23H24N4O3/c1-14(2)21-26-23(30-27-21)18-7-5-6-15(3)20(18)25-19(28)13-10-16-8-11-17(12-9-16)22(29)24-4/h5-14H,1-4H3,(H,24,29)(H,25,28)/b13-10+ |
| InChIKey | NGRHLGDNIOMGHI-JLHYYAGUSA-N |
| XLogP | 4.18 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|