C20H30N2OS — CID 56568813
N-[1-(3-methylbut-2-enyl)piperidin-4-yl]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carboxamide (PubChem CID 56568813) has the molecular formula C20H30N2OS and a molecular weight of 346.54 g/mol. Its IUPAC name is N-[1-(3-methylbut-2-enyl)piperidin-4-yl]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carboxamide.
| Compound Name | N-[1-(3-methylbut-2-enyl)piperidin-4-yl]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 56568813 |
| Molecular Formula | C20H30N2OS |
| Molecular Weight | 346.54 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | N-[1-(3-methylbut-2-enyl)piperidin-4-yl]-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carboxamide |
| SMILES | CC(C)=CCN1CCC(NC(=O)c2cc3c(s2)CCCCC3)CC1 |
| InChI | InChI=1S/C20H30N2OS/c1-15(2)8-11-22-12-9-17(10-13-22)21-20(23)19-14-16-6-4-3-5-7-18(16)24-19/h8,14,17H,3-7,9-13H2,1-2H3,(H,21,23) |
| InChIKey | FSQUNPPQIAQYAV-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.54 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|