C26H39N3O3 — CID 56568935
4-[2-(2,6-dimethylpiperidin-1-yl)-2-oxoethoxy]-N-[1-(3-methylbut-2-enyl)piperidin-4-yl]benzamide (PubChem CID 56568935) has the molecular formula C26H39N3O3 and a molecular weight of 441.62 g/mol. Its IUPAC name is 4-[2-(2,6-dimethylpiperidin-1-yl)-2-oxoethoxy]-N-[1-(3-methylbut-2-enyl)piperidin-4-yl]benzamide.
| Compound Name | 4-[2-(2,6-dimethylpiperidin-1-yl)-2-oxoethoxy]-N-[1-(3-methylbut-2-enyl)piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 56568935 |
| Molecular Formula | C26H39N3O3 |
| Molecular Weight | 441.62 g/mol |
| Exact Mass | 441.30 |
| IUPAC Name | 4-[2-(2,6-dimethylpiperidin-1-yl)-2-oxoethoxy]-N-[1-(3-methylbut-2-enyl)piperidin-4-yl]benzamide |
| SMILES | CC(C)=CCN1CCC(NC(=O)c2ccc(OCC(=O)N3C(C)CCCC3C)cc2)CC1 |
| InChI | InChI=1S/C26H39N3O3/c1-19(2)12-15-28-16-13-23(14-17-28)27-26(31)22-8-10-24(11-9-22)32-18-25(30)29-20(3)6-5-7-21(29)4/h8-12,20-21,23H,5-7,13-18H2,1-4H3,(H,27,31) |
| InChIKey | WYZFVRBLVQQCFY-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.62 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|