C23H26FN5OS — CID 56569009
1-(3-fluorophenyl)-N-[1-(3-methylbut-2-enyl)piperidin-4-yl]-5-thiophen-2-yl-1,2,4-triazole-3-carboxamide (PubChem CID 56569009) has the molecular formula C23H26FN5OS and a molecular weight of 439.56 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-N-[1-(3-methylbut-2-enyl)piperidin-4-yl]-5-thiophen-2-yl-1,2,4-triazole-3-carboxamide.
| Compound Name | 1-(3-fluorophenyl)-N-[1-(3-methylbut-2-enyl)piperidin-4-yl]-5-thiophen-2-yl-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 56569009 |
| Molecular Formula | C23H26FN5OS |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | 1-(3-fluorophenyl)-N-[1-(3-methylbut-2-enyl)piperidin-4-yl]-5-thiophen-2-yl-1,2,4-triazole-3-carboxamide |
| SMILES | CC(C)=CCN1CCC(NC(=O)c2nc(-c3cccs3)n(-c3cccc(F)c3)n2)CC1 |
| InChI | InChI=1S/C23H26FN5OS/c1-16(2)8-11-28-12-9-18(10-13-28)25-23(30)21-26-22(20-7-4-14-31-20)29(27-21)19-6-3-5-17(24)15-19/h3-8,14-15,18H,9-13H2,1-2H3,(H,25,30) |
| InChIKey | SHFQYCSEJVOMFQ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|