C23H32FN3O2 — CID 56569031
1-(4-fluorobenzoyl)-N-[1-(3-methylbut-2-enyl)piperidin-4-yl]piperidine-4-carboxamide (PubChem CID 56569031) has the molecular formula C23H32FN3O2 and a molecular weight of 401.53 g/mol. Its IUPAC name is 1-(4-fluorobenzoyl)-N-[1-(3-methylbut-2-enyl)piperidin-4-yl]piperidine-4-carboxamide.
| Compound Name | 1-(4-fluorobenzoyl)-N-[1-(3-methylbut-2-enyl)piperidin-4-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 56569031 |
| Molecular Formula | C23H32FN3O2 |
| Molecular Weight | 401.53 g/mol |
| Exact Mass | 401.25 |
| IUPAC Name | 1-(4-fluorobenzoyl)-N-[1-(3-methylbut-2-enyl)piperidin-4-yl]piperidine-4-carboxamide |
| SMILES | CC(C)=CCN1CCC(NC(=O)C2CCN(C(=O)c3ccc(F)cc3)CC2)CC1 |
| InChI | InChI=1S/C23H32FN3O2/c1-17(2)7-12-26-13-10-21(11-14-26)25-22(28)18-8-15-27(16-9-18)23(29)19-3-5-20(24)6-4-19/h3-7,18,21H,8-16H2,1-2H3,(H,25,28) |
| InChIKey | VEDGVIUUIQTIIB-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.53 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|