C23H26N6O3 — CID 56569335
[2-oxo-2-(1,2,3,4-tetrahydronaphthalen-1-ylamino)ethyl] 1-([1,2,4]triazolo[4,3-b]pyridazin-6-yl)piperidine-4-carboxylate (PubChem CID 56569335) has the molecular formula C23H26N6O3 and a molecular weight of 434.50 g/mol. Its IUPAC name is [2-oxo-2-(1,2,3,4-tetrahydronaphthalen-1-ylamino)ethyl] 1-([1,2,4]triazolo[4,3-b]pyridazin-6-yl)piperidine-4-carboxylate.
| Compound Name | [2-oxo-2-(1,2,3,4-tetrahydronaphthalen-1-ylamino)ethyl] 1-([1,2,4]triazolo[4,3-b]pyridazin-6-yl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 56569335 |
| Molecular Formula | C23H26N6O3 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | [2-oxo-2-(1,2,3,4-tetrahydronaphthalen-1-ylamino)ethyl] 1-([1,2,4]triazolo[4,3-b]pyridazin-6-yl)piperidine-4-carboxylate |
| SMILES | O=C(COC(=O)C1CCN(c2ccc3nncn3n2)CC1)NC1CCCc2ccccc21 |
| InChI | InChI=1S/C23H26N6O3/c30-22(25-19-7-3-5-16-4-1-2-6-18(16)19)14-32-23(31)17-10-12-28(13-11-17)21-9-8-20-26-24-15-29(20)27-21/h1-2,4,6,8-9,15,17,19H,3,5,7,10-14H2,(H,25,30) |
| InChIKey | QMIBJDIMCUZGLB-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 101.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |