C18H27N9O2S — CID 56572605
2-[[5,7-bis(ethylamino)-[1,2,4]triazolo[4,3-a][1,3,5]triazin-3-yl]sulfanyl]-N-(2-cyanoethyl)-N-(oxan-4-yl)acetamide (PubChem CID 56572605) has the molecular formula C18H27N9O2S and a molecular weight of 433.54 g/mol. Its IUPAC name is 2-[[5,7-bis(ethylamino)-[1,2,4]triazolo[4,3-a][1,3,5]triazin-3-yl]sulfanyl]-N-(2-cyanoethyl)-N-(oxan-4-yl)acetamide.
| Compound Name | 2-[[5,7-bis(ethylamino)-[1,2,4]triazolo[4,3-a][1,3,5]triazin-3-yl]sulfanyl]-N-(2-cyanoethyl)-N-(oxan-4-yl)acetamide |
|---|---|
| PubChem CID | 56572605 |
| Molecular Formula | C18H27N9O2S |
| Molecular Weight | 433.54 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | 2-[[5,7-bis(ethylamino)-[1,2,4]triazolo[4,3-a][1,3,5]triazin-3-yl]sulfanyl]-N-(2-cyanoethyl)-N-(oxan-4-yl)acetamide |
| SMILES | CCNc1nc(NCC)n2c(SCC(=O)N(CCC#N)C3CCOCC3)nnc2n1 |
| InChI | InChI=1S/C18H27N9O2S/c1-3-20-15-22-16(21-4-2)27-17(23-15)24-25-18(27)30-12-14(28)26(9-5-8-19)13-6-10-29-11-7-13/h13H,3-7,9-12H2,1-2H3,(H2,20,21,22,23,24) |
| InChIKey | MJHTVZKNYHYMGY-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 133.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.54 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het_thio_65_B(2)', 'substructure': 'N/A'} |
|---|