C21H29N3O5S — CID 56572695
N-(2-cyanoethyl)-1-(4-methoxyphenyl)sulfonyl-N-(oxan-4-yl)piperidine-3-carboxamide (PubChem CID 56572695) has the molecular formula C21H29N3O5S and a molecular weight of 435.55 g/mol. Its IUPAC name is N-(2-cyanoethyl)-1-(4-methoxyphenyl)sulfonyl-N-(oxan-4-yl)piperidine-3-carboxamide.
| Compound Name | N-(2-cyanoethyl)-1-(4-methoxyphenyl)sulfonyl-N-(oxan-4-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 56572695 |
| Molecular Formula | C21H29N3O5S |
| Molecular Weight | 435.55 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | N-(2-cyanoethyl)-1-(4-methoxyphenyl)sulfonyl-N-(oxan-4-yl)piperidine-3-carboxamide |
| SMILES | COc1ccc(S(=O)(=O)N2CCCC(C(=O)N(CCC#N)C3CCOCC3)C2)cc1 |
| InChI | InChI=1S/C21H29N3O5S/c1-28-19-5-7-20(8-6-19)30(26,27)23-12-2-4-17(16-23)21(25)24(13-3-11-22)18-9-14-29-15-10-18/h5-8,17-18H,2-4,9-10,12-16H2,1H3 |
| InChIKey | GJVCRCRQQJAEPB-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 99.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.55 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |