C22H25N3O3S — CID 56572818
N-(2-cyanoethyl)-N-(4-ethoxyphenyl)-1-(thiophene-2-carbonyl)piperidine-4-carboxamide (PubChem CID 56572818) has the molecular formula C22H25N3O3S and a molecular weight of 411.53 g/mol. Its IUPAC name is N-(2-cyanoethyl)-N-(4-ethoxyphenyl)-1-(thiophene-2-carbonyl)piperidine-4-carboxamide.
| Compound Name | N-(2-cyanoethyl)-N-(4-ethoxyphenyl)-1-(thiophene-2-carbonyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 56572818 |
| Molecular Formula | C22H25N3O3S |
| Molecular Weight | 411.53 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | N-(2-cyanoethyl)-N-(4-ethoxyphenyl)-1-(thiophene-2-carbonyl)piperidine-4-carboxamide |
| SMILES | CCOc1ccc(N(CCC#N)C(=O)C2CCN(C(=O)c3cccs3)CC2)cc1 |
| InChI | InChI=1S/C22H25N3O3S/c1-2-28-19-8-6-18(7-9-19)25(13-4-12-23)21(26)17-10-14-24(15-11-17)22(27)20-5-3-16-29-20/h3,5-9,16-17H,2,4,10-11,13-15H2,1H3 |
| InChIKey | SVMNYUIFEKZAKX-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 73.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.53 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |