C20H22FN5S — CID 56574520
2-(4-cyclohex-2-en-1-ylpiperazin-1-yl)-6-(4-fluorophenyl)imidazo[2,1-b][1,3,4]thiadiazole (PubChem CID 56574520) has the molecular formula C20H22FN5S and a molecular weight of 383.50 g/mol. Its IUPAC name is 2-(4-cyclohex-2-en-1-ylpiperazin-1-yl)-6-(4-fluorophenyl)imidazo[2,1-b][1,3,4]thiadiazole.
| Compound Name | 2-(4-cyclohex-2-en-1-ylpiperazin-1-yl)-6-(4-fluorophenyl)imidazo[2,1-b][1,3,4]thiadiazole |
|---|---|
| PubChem CID | 56574520 |
| Molecular Formula | C20H22FN5S |
| Molecular Weight | 383.50 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | 2-(4-cyclohex-2-en-1-ylpiperazin-1-yl)-6-(4-fluorophenyl)imidazo[2,1-b][1,3,4]thiadiazole |
| SMILES | Fc1ccc(-c2cn3nc(N4CCN(C5C=CCCC5)CC4)sc3n2)cc1 |
| InChI | InChI=1S/C20H22FN5S/c21-16-8-6-15(7-9-16)18-14-26-19(22-18)27-20(23-26)25-12-10-24(11-13-25)17-4-2-1-3-5-17/h2,4,6-9,14,17H,1,3,5,10-13H2 |
| InChIKey | QWWAIVJJFRYIET-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 36.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.50 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|