C19H24FN3 — CID 56574718
N-[3-[3-(4-fluorophenyl)-1H-pyrazol-5-yl]propyl]-N-methylcyclohex-2-en-1-amine (PubChem CID 56574718) has the molecular formula C19H24FN3 and a molecular weight of 313.42 g/mol. Its IUPAC name is N-[3-[3-(4-fluorophenyl)-1H-pyrazol-5-yl]propyl]-N-methylcyclohex-2-en-1-amine.
| Compound Name | N-[3-[3-(4-fluorophenyl)-1H-pyrazol-5-yl]propyl]-N-methylcyclohex-2-en-1-amine |
|---|---|
| PubChem CID | 56574718 |
| Molecular Formula | C19H24FN3 |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.20 |
| IUPAC Name | N-[3-[3-(4-fluorophenyl)-1H-pyrazol-5-yl]propyl]-N-methylcyclohex-2-en-1-amine |
| SMILES | CN(CCCc1cc(-c2ccc(F)cc2)n[nH]1)C1C=CCCC1 |
| InChI | InChI=1S/C19H24FN3/c1-23(18-7-3-2-4-8-18)13-5-6-17-14-19(22-21-17)15-9-11-16(20)12-10-15/h3,7,9-12,14,18H,2,4-6,8,13H2,1H3,(H,21,22) |
| InChIKey | ZERPDNOZWDLVDR-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|