About N-[2-(3,4-dimethoxyphenyl)ethyl]-4-(4-fluorophenoxy)-N-methylpyrimidin-2-amine
N-[2-(3,4-dimethoxyphenyl)ethyl]-4-(4-fluorophenoxy)-N-methylpyrimidin-2-amine (PubChem CID 56575808) has the molecular formula C21H22FN3O3
and a molecular weight of 383.42 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-4-(4-fluorophenoxy)-N-methylpyrimidin-2-amine.
Molecular Properties
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-4-(4-fluorophenoxy)-N-methylpyrimidin-2-amine |
| PubChem CID | 56575808 |
| Molecular Formula | C21H22FN3O3 |
| Molecular Weight | 383.42 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-4-(4-fluorophenoxy)-N-methylpyrimidin-2-amine |
| SMILES | COc1ccc(CCN(C)c2nccc(Oc3ccc(F)cc3)n2)cc1OC |
| InChI | InChI=1S/C21H22FN3O3/c1-25(13-11-15-4-9-18(26-2)19(14-15)27-3)21-23-12-10-20(24-21)28-17-7-5-16(22)6-8-17/h4-10,12,14H,11,13H2,1-3H3 |
| InChIKey | LBXOBVMCDCTBIU-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 56.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.42 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[2-(3,4-dimethoxyphenyl)ethyl]-4-(4-fluorophenoxy)-N-methylpyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(3,4-dimethoxyphenyl)ethyl]-4-(4-fluorophenoxy)-N-methylpyrimidin-2-amine?
The IUPAC name of N-[2-(3,4-dimethoxyphenyl)ethyl]-4-(4-fluorophenoxy)-N-methylpyrimidin-2-amine (CID 56575808) is N-[2-(3,4-dimethoxyphenyl)ethyl]-4-(4-fluorophenoxy)-N-methylpyrimidin-2-amine.
What is the SMILES notation for N-[2-(3,4-dimethoxyphenyl)ethyl]-4-(4-fluorophenoxy)-N-methylpyrimidin-2-amine?
The canonical SMILES for N-[2-(3,4-dimethoxyphenyl)ethyl]-4-(4-fluorophenoxy)-N-methylpyrimidin-2-amine is COc1ccc(CCN(C)c2nccc(Oc3ccc(F)cc3)n2)cc1OC.
What is the InChIKey of N-[2-(3,4-dimethoxyphenyl)ethyl]-4-(4-fluorophenoxy)-N-methylpyrimidin-2-amine?
The InChIKey is LBXOBVMCDCTBIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22FN3O3/c1-25(13-11-15-4-9-18(26-2)19(14-15)27-3)21-23-12-10-20(24-21)28-17-7-5-16(22)6-8-17/h4-10,12,14H,11,13H2,1-3H3.
What are the key properties of N-[2-(3,4-dimethoxyphenyl)ethyl]-4-(4-fluorophenoxy)-N-methylpyrimidin-2-amine?
N-[2-(3,4-dimethoxyphenyl)ethyl]-4-(4-fluorophenoxy)-N-methylpyrimidin-2-amine has a molecular weight of 383.42 g/mol, XLogP of 4.10, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(3,4-dimethoxyphenyl)ethyl]-4-(4-fluorophenoxy)-N-methylpyrimidin-2-amine is sourced from PubChem (CID 56575808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).