C26H24N2O — CID 56575832
[(3Z)-3-benzylidene-1,2-dihydrocyclopenta[b]quinolin-9-yl]-(4-methylidenepiperidin-1-yl)methanone (PubChem CID 56575832) has the molecular formula C26H24N2O and a molecular weight of 380.49 g/mol. Its IUPAC name is [(3Z)-3-benzylidene-1,2-dihydrocyclopenta[b]quinolin-9-yl]-(4-methylidenepiperidin-1-yl)methanone.
| Compound Name | [(3Z)-3-benzylidene-1,2-dihydrocyclopenta[b]quinolin-9-yl]-(4-methylidenepiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 56575832 |
| Molecular Formula | C26H24N2O |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.19 |
| IUPAC Name | [(3Z)-3-benzylidene-1,2-dihydrocyclopenta[b]quinolin-9-yl]-(4-methylidenepiperidin-1-yl)methanone |
| SMILES | C=C1CCN(C(=O)c2c3c(nc4ccccc24)/C(=C\c2ccccc2)CC3)CC1 |
| InChI | InChI=1S/C26H24N2O/c1-18-13-15-28(16-14-18)26(29)24-21-9-5-6-10-23(21)27-25-20(11-12-22(24)25)17-19-7-3-2-4-8-19/h2-10,17H,1,11-16H2/b20-17- |
| InChIKey | PAVIXERAFDBUHK-JZJYNLBNSA-N |
| XLogP | 5.51 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|