C22H21N5OS — CID 56576153
N-[(4-cyclopropyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-2-(2-phenylindol-1-yl)acetamide (PubChem CID 56576153) has the molecular formula C22H21N5OS and a molecular weight of 403.51 g/mol. Its IUPAC name is N-[(4-cyclopropyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-2-(2-phenylindol-1-yl)acetamide.
| Compound Name | N-[(4-cyclopropyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-2-(2-phenylindol-1-yl)acetamide |
|---|---|
| PubChem CID | 56576153 |
| Molecular Formula | C22H21N5OS |
| Molecular Weight | 403.51 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | N-[(4-cyclopropyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-2-(2-phenylindol-1-yl)acetamide |
| SMILES | O=C(Cn1c(-c2ccccc2)cc2ccccc21)NCc1n[nH]c(=S)n1C1CC1 |
| InChI | InChI=1S/C22H21N5OS/c28-21(23-13-20-24-25-22(29)27(20)17-10-11-17)14-26-18-9-5-4-8-16(18)12-19(26)15-6-2-1-3-7-15/h1-9,12,17H,10-11,13-14H2,(H,23,28)(H,25,29) |
| InChIKey | ZQYRVDJMSRPUGP-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 67.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.51 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|