C18H18N4O4S2 — CID 56576475
5-(benzenesulfonylmethyl)-N-[(4-cyclopropyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]furan-2-carboxamide (PubChem CID 56576475) has the molecular formula C18H18N4O4S2 and a molecular weight of 418.50 g/mol. Its IUPAC name is 5-(benzenesulfonylmethyl)-N-[(4-cyclopropyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]furan-2-carboxamide.
| Compound Name | 5-(benzenesulfonylmethyl)-N-[(4-cyclopropyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 56576475 |
| Molecular Formula | C18H18N4O4S2 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.08 |
| IUPAC Name | 5-(benzenesulfonylmethyl)-N-[(4-cyclopropyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]furan-2-carboxamide |
| SMILES | O=C(NCc1n[nH]c(=S)n1C1CC1)c1ccc(CS(=O)(=O)c2ccccc2)o1 |
| InChI | InChI=1S/C18H18N4O4S2/c23-17(19-10-16-20-21-18(27)22(16)12-6-7-12)15-9-8-13(26-15)11-28(24,25)14-4-2-1-3-5-14/h1-5,8-9,12H,6-7,10-11H2,(H,19,23)(H,21,27) |
| InChIKey | DSAPEXKEADARPA-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 109.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|