C22H23N5OS — CID 56578545
N-[2-(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]-2-(2-phenylindol-1-yl)acetamide (PubChem CID 56578545) has the molecular formula C22H23N5OS and a molecular weight of 405.53 g/mol. Its IUPAC name is N-[2-(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]-2-(2-phenylindol-1-yl)acetamide.
| Compound Name | N-[2-(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]-2-(2-phenylindol-1-yl)acetamide |
|---|---|
| PubChem CID | 56578545 |
| Molecular Formula | C22H23N5OS |
| Molecular Weight | 405.53 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | N-[2-(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]-2-(2-phenylindol-1-yl)acetamide |
| SMILES | CCn1c(CCNC(=O)Cn2c(-c3ccccc3)cc3ccccc32)n[nH]c1=S |
| InChI | InChI=1S/C22H23N5OS/c1-2-26-20(24-25-22(26)29)12-13-23-21(28)15-27-18-11-7-6-10-17(18)14-19(27)16-8-4-3-5-9-16/h3-11,14H,2,12-13,15H2,1H3,(H,23,28)(H,25,29) |
| InChIKey | JBCDOPYJCJWHRN-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 67.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.53 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|