C21H23N5O2S — CID 56579701
S-[4-[(5-propan-2-yl-1-pyridin-2-ylpyrazole-4-carbonyl)amino]phenyl] N,N-dimethylcarbamothioate (PubChem CID 56579701) has the molecular formula C21H23N5O2S and a molecular weight of 409.52 g/mol. Its IUPAC name is S-[4-[(5-propan-2-yl-1-pyridin-2-ylpyrazole-4-carbonyl)amino]phenyl] N,N-dimethylcarbamothioate.
| Compound Name | S-[4-[(5-propan-2-yl-1-pyridin-2-ylpyrazole-4-carbonyl)amino]phenyl] N,N-dimethylcarbamothioate |
|---|---|
| PubChem CID | 56579701 |
| Molecular Formula | C21H23N5O2S |
| Molecular Weight | 409.52 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | S-[4-[(5-propan-2-yl-1-pyridin-2-ylpyrazole-4-carbonyl)amino]phenyl] N,N-dimethylcarbamothioate |
| SMILES | CC(C)c1c(C(=O)Nc2ccc(SC(=O)N(C)C)cc2)cnn1-c1ccccn1 |
| InChI | InChI=1S/C21H23N5O2S/c1-14(2)19-17(13-23-26(19)18-7-5-6-12-22-18)20(27)24-15-8-10-16(11-9-15)29-21(28)25(3)4/h5-14H,1-4H3,(H,24,27) |
| InChIKey | BJVDTBWIULPOAU-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.52 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|