C23H23N3O4S — CID 56579841
S-[4-[[2-(furan-2-carbonylamino)-3-phenylpropanoyl]amino]phenyl] N,N-dimethylcarbamothioate (PubChem CID 56579841) has the molecular formula C23H23N3O4S and a molecular weight of 437.52 g/mol. Its IUPAC name is S-[4-[[2-(furan-2-carbonylamino)-3-phenylpropanoyl]amino]phenyl] N,N-dimethylcarbamothioate.
| Compound Name | S-[4-[[2-(furan-2-carbonylamino)-3-phenylpropanoyl]amino]phenyl] N,N-dimethylcarbamothioate |
|---|---|
| PubChem CID | 56579841 |
| Molecular Formula | C23H23N3O4S |
| Molecular Weight | 437.52 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | S-[4-[[2-(furan-2-carbonylamino)-3-phenylpropanoyl]amino]phenyl] N,N-dimethylcarbamothioate |
| SMILES | CN(C)C(=O)Sc1ccc(NC(=O)C(Cc2ccccc2)NC(=O)c2ccco2)cc1 |
| InChI | InChI=1S/C23H23N3O4S/c1-26(2)23(29)31-18-12-10-17(11-13-18)24-21(27)19(15-16-7-4-3-5-8-16)25-22(28)20-9-6-14-30-20/h3-14,19H,15H2,1-2H3,(H,24,27)(H,25,28) |
| InChIKey | YTZJQFXKLFDOKT-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.52 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|