About 4-[2-(6-bromo-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]benzenesulfonamide
4-[2-(6-bromo-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]benzenesulfonamide (PubChem CID 56580624) has the molecular formula C17H17BrN2O3S
and a molecular weight of 409.31 g/mol. Its IUPAC name is 4-[2-(6-bromo-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]benzenesulfonamide.
Molecular Properties
| Compound Name | 4-[2-(6-bromo-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]benzenesulfonamide |
| PubChem CID | 56580624 |
| Molecular Formula | C17H17BrN2O3S |
| Molecular Weight | 409.31 g/mol |
| Exact Mass | 408.01 |
| IUPAC Name | 4-[2-(6-bromo-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(CC(=O)N2CCCc3cc(Br)ccc32)cc1 |
| InChI | InChI=1S/C17H17BrN2O3S/c18-14-5-8-16-13(11-14)2-1-9-20(16)17(21)10-12-3-6-15(7-4-12)24(19,22)23/h3-8,11H,1-2,9-10H2,(H2,19,22,23) |
| InChIKey | ZPQXMKVVBRUNMO-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 409.31 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[2-(6-bromo-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(6-bromo-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]benzenesulfonamide?
The IUPAC name of 4-[2-(6-bromo-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]benzenesulfonamide (CID 56580624) is 4-[2-(6-bromo-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]benzenesulfonamide.
What is the SMILES notation for 4-[2-(6-bromo-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]benzenesulfonamide?
The canonical SMILES for 4-[2-(6-bromo-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]benzenesulfonamide is NS(=O)(=O)c1ccc(CC(=O)N2CCCc3cc(Br)ccc32)cc1.
What is the InChIKey of 4-[2-(6-bromo-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]benzenesulfonamide?
The InChIKey is ZPQXMKVVBRUNMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17BrN2O3S/c18-14-5-8-16-13(11-14)2-1-9-20(16)17(21)10-12-3-6-15(7-4-12)24(19,22)23/h3-8,11H,1-2,9-10H2,(H2,19,22,23).
What are the key properties of 4-[2-(6-bromo-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]benzenesulfonamide?
4-[2-(6-bromo-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]benzenesulfonamide has a molecular weight of 409.31 g/mol, XLogP of 2.62, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(6-bromo-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]benzenesulfonamide is sourced from PubChem (CID 56580624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).