C19H17Cl2N3O2 — CID 56581250
5-chloro-N-(5-chloro-2-hydroxyphenyl)-3-methyl-1-[(4-methylphenyl)methyl]pyrazole-4-carboxamide (PubChem CID 56581250) has the molecular formula C19H17Cl2N3O2 and a molecular weight of 390.27 g/mol. Its IUPAC name is 5-chloro-N-(5-chloro-2-hydroxyphenyl)-3-methyl-1-[(4-methylphenyl)methyl]pyrazole-4-carboxamide.
| Compound Name | 5-chloro-N-(5-chloro-2-hydroxyphenyl)-3-methyl-1-[(4-methylphenyl)methyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 56581250 |
| Molecular Formula | C19H17Cl2N3O2 |
| Molecular Weight | 390.27 g/mol |
| Exact Mass | 389.07 |
| IUPAC Name | 5-chloro-N-(5-chloro-2-hydroxyphenyl)-3-methyl-1-[(4-methylphenyl)methyl]pyrazole-4-carboxamide |
| SMILES | Cc1ccc(Cn2nc(C)c(C(=O)Nc3cc(Cl)ccc3O)c2Cl)cc1 |
| InChI | InChI=1S/C19H17Cl2N3O2/c1-11-3-5-13(6-4-11)10-24-18(21)17(12(2)23-24)19(26)22-15-9-14(20)7-8-16(15)25/h3-9,25H,10H2,1-2H3,(H,22,26) |
| InChIKey | HOOHBDBIIMHTQV-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.27 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|