C18H17Cl2N3O2S — CID 56581685
1-(3,4-dichlorophenyl)-N-[2-(4-pyrazol-1-ylphenyl)ethyl]methanesulfonamide (PubChem CID 56581685) has the molecular formula C18H17Cl2N3O2S and a molecular weight of 410.33 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-N-[2-(4-pyrazol-1-ylphenyl)ethyl]methanesulfonamide.
| Compound Name | 1-(3,4-dichlorophenyl)-N-[2-(4-pyrazol-1-ylphenyl)ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 56581685 |
| Molecular Formula | C18H17Cl2N3O2S |
| Molecular Weight | 410.33 g/mol |
| Exact Mass | 409.04 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-N-[2-(4-pyrazol-1-ylphenyl)ethyl]methanesulfonamide |
| SMILES | O=S(=O)(Cc1ccc(Cl)c(Cl)c1)NCCc1ccc(-n2cccn2)cc1 |
| InChI | InChI=1S/C18H17Cl2N3O2S/c19-17-7-4-15(12-18(17)20)13-26(24,25)22-10-8-14-2-5-16(6-3-14)23-11-1-9-21-23/h1-7,9,11-12,22H,8,10,13H2 |
| InChIKey | GLPLNPUUUCAAMP-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.33 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |