C19H12N2O4 — CID 565828
N-(1,3-dioxo-2-phenylisoindol-5-yl)furan-2-carboxamide (PubChem CID 565828) has the molecular formula C19H12N2O4 and a molecular weight of 332.32 g/mol. Its IUPAC name is N-(1,3-dioxo-2-phenylisoindol-5-yl)furan-2-carboxamide.
| Compound Name | N-(1,3-dioxo-2-phenylisoindol-5-yl)furan-2-carboxamide |
|---|---|
| PubChem CID | 565828 |
| Molecular Formula | C19H12N2O4 |
| Molecular Weight | 332.32 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | N-(1,3-dioxo-2-phenylisoindol-5-yl)furan-2-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)C(=O)N(c1ccccc1)C2=O)c1ccco1 |
| InChI | InChI=1S/C19H12N2O4/c22-17(16-7-4-10-25-16)20-12-8-9-14-15(11-12)19(24)21(18(14)23)13-5-2-1-3-6-13/h1-11H,(H,20,22) |
| InChIKey | XXYVMBQWFBBMHX-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.32 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|