C20H23ClN4 — CID 56584071
3-chloro-6-[4-[(4-propan-2-ylphenyl)methyl]piperazin-1-yl]pyridine-2-carbonitrile (PubChem CID 56584071) has the molecular formula C20H23ClN4 and a molecular weight of 354.89 g/mol. Its IUPAC name is 3-chloro-6-[4-[(4-propan-2-ylphenyl)methyl]piperazin-1-yl]pyridine-2-carbonitrile.
| Compound Name | 3-chloro-6-[4-[(4-propan-2-ylphenyl)methyl]piperazin-1-yl]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 56584071 |
| Molecular Formula | C20H23ClN4 |
| Molecular Weight | 354.89 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | 3-chloro-6-[4-[(4-propan-2-ylphenyl)methyl]piperazin-1-yl]pyridine-2-carbonitrile |
| SMILES | CC(C)c1ccc(CN2CCN(c3ccc(Cl)c(C#N)n3)CC2)cc1 |
| InChI | InChI=1S/C20H23ClN4/c1-15(2)17-5-3-16(4-6-17)14-24-9-11-25(12-10-24)20-8-7-18(21)19(13-22)23-20/h3-8,15H,9-12,14H2,1-2H3 |
| InChIKey | LNIQLDQBWQWLIC-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 43.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.89 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |