C21H26ClN5 — CID 56584147
3-chloro-6-[4-[4-(3-methylphenyl)piperazin-1-yl]butan-2-ylamino]pyridine-2-carbonitrile (PubChem CID 56584147) has the molecular formula C21H26ClN5 and a molecular weight of 383.93 g/mol. Its IUPAC name is 3-chloro-6-[4-[4-(3-methylphenyl)piperazin-1-yl]butan-2-ylamino]pyridine-2-carbonitrile.
| Compound Name | 3-chloro-6-[4-[4-(3-methylphenyl)piperazin-1-yl]butan-2-ylamino]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 56584147 |
| Molecular Formula | C21H26ClN5 |
| Molecular Weight | 383.93 g/mol |
| Exact Mass | 383.19 |
| IUPAC Name | 3-chloro-6-[4-[4-(3-methylphenyl)piperazin-1-yl]butan-2-ylamino]pyridine-2-carbonitrile |
| SMILES | Cc1cccc(N2CCN(CCC(C)Nc3ccc(Cl)c(C#N)n3)CC2)c1 |
| InChI | InChI=1S/C21H26ClN5/c1-16-4-3-5-18(14-16)27-12-10-26(11-13-27)9-8-17(2)24-21-7-6-19(22)20(15-23)25-21/h3-7,14,17H,8-13H2,1-2H3,(H,24,25) |
| InChIKey | YFTMMQJHPNOLNN-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 55.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.93 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |