About 4-[4-[(2-ethyl-1,3-thiazol-4-yl)methyl]piperazin-1-yl]-2-(trifluoromethyl)benzonitrile
4-[4-[(2-ethyl-1,3-thiazol-4-yl)methyl]piperazin-1-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 56584217) has the molecular formula C18H19F3N4S
and a molecular weight of 380.44 g/mol. Its IUPAC name is 4-[4-[(2-ethyl-1,3-thiazol-4-yl)methyl]piperazin-1-yl]-2-(trifluoromethyl)benzonitrile.
Molecular Properties
| Compound Name | 4-[4-[(2-ethyl-1,3-thiazol-4-yl)methyl]piperazin-1-yl]-2-(trifluoromethyl)benzonitrile |
| PubChem CID | 56584217 |
| Molecular Formula | C18H19F3N4S |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | 4-[4-[(2-ethyl-1,3-thiazol-4-yl)methyl]piperazin-1-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | CCc1nc(CN2CCN(c3ccc(C#N)c(C(F)(F)F)c3)CC2)cs1 |
| InChI | InChI=1S/C18H19F3N4S/c1-2-17-23-14(12-26-17)11-24-5-7-25(8-6-24)15-4-3-13(10-22)16(9-15)18(19,20)21/h3-4,9,12H,2,5-8,11H2,1H3 |
| InChIKey | RINJYPYFDBEZFM-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 43.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[4-[(2-ethyl-1,3-thiazol-4-yl)methyl]piperazin-1-yl]-2-(trifluoromethyl)benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-[(2-ethyl-1,3-thiazol-4-yl)methyl]piperazin-1-yl]-2-(trifluoromethyl)benzonitrile?
The IUPAC name of 4-[4-[(2-ethyl-1,3-thiazol-4-yl)methyl]piperazin-1-yl]-2-(trifluoromethyl)benzonitrile (CID 56584217) is 4-[4-[(2-ethyl-1,3-thiazol-4-yl)methyl]piperazin-1-yl]-2-(trifluoromethyl)benzonitrile.
What is the SMILES notation for 4-[4-[(2-ethyl-1,3-thiazol-4-yl)methyl]piperazin-1-yl]-2-(trifluoromethyl)benzonitrile?
The canonical SMILES for 4-[4-[(2-ethyl-1,3-thiazol-4-yl)methyl]piperazin-1-yl]-2-(trifluoromethyl)benzonitrile is CCc1nc(CN2CCN(c3ccc(C#N)c(C(F)(F)F)c3)CC2)cs1.
What is the InChIKey of 4-[4-[(2-ethyl-1,3-thiazol-4-yl)methyl]piperazin-1-yl]-2-(trifluoromethyl)benzonitrile?
The InChIKey is RINJYPYFDBEZFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19F3N4S/c1-2-17-23-14(12-26-17)11-24-5-7-25(8-6-24)15-4-3-13(10-22)16(9-15)18(19,20)21/h3-4,9,12H,2,5-8,11H2,1H3.
What are the key properties of 4-[4-[(2-ethyl-1,3-thiazol-4-yl)methyl]piperazin-1-yl]-2-(trifluoromethyl)benzonitrile?
4-[4-[(2-ethyl-1,3-thiazol-4-yl)methyl]piperazin-1-yl]-2-(trifluoromethyl)benzonitrile has a molecular weight of 380.44 g/mol, XLogP of 3.92, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-[(2-ethyl-1,3-thiazol-4-yl)methyl]piperazin-1-yl]-2-(trifluoromethyl)benzonitrile is sourced from PubChem (CID 56584217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).