About 4-chloro-2-(2,4-difluorophenyl)-5-[[phenyl(pyridin-2-yl)methyl]amino]pyridazin-3-one
4-chloro-2-(2,4-difluorophenyl)-5-[[phenyl(pyridin-2-yl)methyl]amino]pyridazin-3-one (PubChem CID 56584790) has the molecular formula C22H15ClF2N4O
and a molecular weight of 424.84 g/mol. Its IUPAC name is 4-chloro-2-(2,4-difluorophenyl)-5-[[phenyl(pyridin-2-yl)methyl]amino]pyridazin-3-one.
Molecular Properties
| Compound Name | 4-chloro-2-(2,4-difluorophenyl)-5-[[phenyl(pyridin-2-yl)methyl]amino]pyridazin-3-one |
| PubChem CID | 56584790 |
| Molecular Formula | C22H15ClF2N4O |
| Molecular Weight | 424.84 g/mol |
| Exact Mass | 424.09 |
| IUPAC Name | 4-chloro-2-(2,4-difluorophenyl)-5-[[phenyl(pyridin-2-yl)methyl]amino]pyridazin-3-one |
| SMILES | O=c1c(Cl)c(NC(c2ccccc2)c2ccccn2)cnn1-c1ccc(F)cc1F |
| InChI | InChI=1S/C22H15ClF2N4O/c23-20-18(13-27-29(22(20)30)19-10-9-15(24)12-16(19)25)28-21(14-6-2-1-3-7-14)17-8-4-5-11-26-17/h1-13,21,28H |
| InChIKey | JQXFEANREJJZGB-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 424.84 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-chloro-2-(2,4-difluorophenyl)-5-[[phenyl(pyridin-2-yl)methyl]amino]pyridazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2-(2,4-difluorophenyl)-5-[[phenyl(pyridin-2-yl)methyl]amino]pyridazin-3-one?
The IUPAC name of 4-chloro-2-(2,4-difluorophenyl)-5-[[phenyl(pyridin-2-yl)methyl]amino]pyridazin-3-one (CID 56584790) is 4-chloro-2-(2,4-difluorophenyl)-5-[[phenyl(pyridin-2-yl)methyl]amino]pyridazin-3-one.
What is the SMILES notation for 4-chloro-2-(2,4-difluorophenyl)-5-[[phenyl(pyridin-2-yl)methyl]amino]pyridazin-3-one?
The canonical SMILES for 4-chloro-2-(2,4-difluorophenyl)-5-[[phenyl(pyridin-2-yl)methyl]amino]pyridazin-3-one is O=c1c(Cl)c(NC(c2ccccc2)c2ccccn2)cnn1-c1ccc(F)cc1F.
What is the InChIKey of 4-chloro-2-(2,4-difluorophenyl)-5-[[phenyl(pyridin-2-yl)methyl]amino]pyridazin-3-one?
The InChIKey is JQXFEANREJJZGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H15ClF2N4O/c23-20-18(13-27-29(22(20)30)19-10-9-15(24)12-16(19)25)28-21(14-6-2-1-3-7-14)17-8-4-5-11-26-17/h1-13,21,28H.
What are the key properties of 4-chloro-2-(2,4-difluorophenyl)-5-[[phenyl(pyridin-2-yl)methyl]amino]pyridazin-3-one?
4-chloro-2-(2,4-difluorophenyl)-5-[[phenyl(pyridin-2-yl)methyl]amino]pyridazin-3-one has a molecular weight of 424.84 g/mol, XLogP of 4.76, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2-(2,4-difluorophenyl)-5-[[phenyl(pyridin-2-yl)methyl]amino]pyridazin-3-one is sourced from PubChem (CID 56584790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).