About N-[cyano-(2,4-difluorophenyl)methyl]-4-[3-(trifluoromethyl)pyrazol-1-yl]benzamide
N-[cyano-(2,4-difluorophenyl)methyl]-4-[3-(trifluoromethyl)pyrazol-1-yl]benzamide (PubChem CID 56585394) has the molecular formula C19H11F5N4O
and a molecular weight of 406.31 g/mol. Its IUPAC name is N-[cyano-(2,4-difluorophenyl)methyl]-4-[3-(trifluoromethyl)pyrazol-1-yl]benzamide.
Molecular Properties
| Compound Name | N-[cyano-(2,4-difluorophenyl)methyl]-4-[3-(trifluoromethyl)pyrazol-1-yl]benzamide |
| PubChem CID | 56585394 |
| Molecular Formula | C19H11F5N4O |
| Molecular Weight | 406.31 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | N-[cyano-(2,4-difluorophenyl)methyl]-4-[3-(trifluoromethyl)pyrazol-1-yl]benzamide |
| SMILES | N#CC(NC(=O)c1ccc(-n2ccc(C(F)(F)F)n2)cc1)c1ccc(F)cc1F |
| InChI | InChI=1S/C19H11F5N4O/c20-12-3-6-14(15(21)9-12)16(10-25)26-18(29)11-1-4-13(5-2-11)28-8-7-17(27-28)19(22,23)24/h1-9,16H,(H,26,29) |
| InChIKey | SJHBJEHNNMGHBD-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 70.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.31 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[cyano-(2,4-difluorophenyl)methyl]-4-[3-(trifluoromethyl)pyrazol-1-yl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[cyano-(2,4-difluorophenyl)methyl]-4-[3-(trifluoromethyl)pyrazol-1-yl]benzamide?
The IUPAC name of N-[cyano-(2,4-difluorophenyl)methyl]-4-[3-(trifluoromethyl)pyrazol-1-yl]benzamide (CID 56585394) is N-[cyano-(2,4-difluorophenyl)methyl]-4-[3-(trifluoromethyl)pyrazol-1-yl]benzamide.
What is the SMILES notation for N-[cyano-(2,4-difluorophenyl)methyl]-4-[3-(trifluoromethyl)pyrazol-1-yl]benzamide?
The canonical SMILES for N-[cyano-(2,4-difluorophenyl)methyl]-4-[3-(trifluoromethyl)pyrazol-1-yl]benzamide is N#CC(NC(=O)c1ccc(-n2ccc(C(F)(F)F)n2)cc1)c1ccc(F)cc1F.
What is the InChIKey of N-[cyano-(2,4-difluorophenyl)methyl]-4-[3-(trifluoromethyl)pyrazol-1-yl]benzamide?
The InChIKey is SJHBJEHNNMGHBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H11F5N4O/c20-12-3-6-14(15(21)9-12)16(10-25)26-18(29)11-1-4-13(5-2-11)28-8-7-17(27-28)19(22,23)24/h1-9,16H,(H,26,29).
What are the key properties of N-[cyano-(2,4-difluorophenyl)methyl]-4-[3-(trifluoromethyl)pyrazol-1-yl]benzamide?
N-[cyano-(2,4-difluorophenyl)methyl]-4-[3-(trifluoromethyl)pyrazol-1-yl]benzamide has a molecular weight of 406.31 g/mol, XLogP of 4.16, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[cyano-(2,4-difluorophenyl)methyl]-4-[3-(trifluoromethyl)pyrazol-1-yl]benzamide is sourced from PubChem (CID 56585394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).