C24H27N3O3S — CID 56586349
N-(3-anilinopropyl)-2-methyl-5-[(2-methylphenyl)sulfamoyl]benzamide (PubChem CID 56586349) has the molecular formula C24H27N3O3S and a molecular weight of 437.57 g/mol. Its IUPAC name is N-(3-anilinopropyl)-2-methyl-5-[(2-methylphenyl)sulfamoyl]benzamide.
| Compound Name | N-(3-anilinopropyl)-2-methyl-5-[(2-methylphenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 56586349 |
| Molecular Formula | C24H27N3O3S |
| Molecular Weight | 437.57 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | N-(3-anilinopropyl)-2-methyl-5-[(2-methylphenyl)sulfamoyl]benzamide |
| SMILES | Cc1ccccc1NS(=O)(=O)c1ccc(C)c(C(=O)NCCCNc2ccccc2)c1 |
| InChI | InChI=1S/C24H27N3O3S/c1-18-13-14-21(31(29,30)27-23-12-7-6-9-19(23)2)17-22(18)24(28)26-16-8-15-25-20-10-4-3-5-11-20/h3-7,9-14,17,25,27H,8,15-16H2,1-2H3,(H,26,28) |
| InChIKey | QYKITUWMSIODLP-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.57 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|