C21H26N2O — CID 56586470
N-(3-anilinopropyl)-1-(3,5-dimethylphenyl)cyclopropane-1-carboxamide (PubChem CID 56586470) has the molecular formula C21H26N2O and a molecular weight of 322.45 g/mol. Its IUPAC name is N-(3-anilinopropyl)-1-(3,5-dimethylphenyl)cyclopropane-1-carboxamide.
| Compound Name | N-(3-anilinopropyl)-1-(3,5-dimethylphenyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 56586470 |
| Molecular Formula | C21H26N2O |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | N-(3-anilinopropyl)-1-(3,5-dimethylphenyl)cyclopropane-1-carboxamide |
| SMILES | Cc1cc(C)cc(C2(C(=O)NCCCNc3ccccc3)CC2)c1 |
| InChI | InChI=1S/C21H26N2O/c1-16-13-17(2)15-18(14-16)21(9-10-21)20(24)23-12-6-11-22-19-7-4-3-5-8-19/h3-5,7-8,13-15,22H,6,9-12H2,1-2H3,(H,23,24) |
| InChIKey | KNWNCGQGKONUDM-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|